

1. Monomethylurea
1. 1-methylurea
2. N-methylurea
3. 598-50-5
4. Monomethylurea
5. Urea, Methyl-
6. Methyl Urea
7. Urea, N-methyl-
8. Methylmocovina
9. Methylharnstoff
10. Vz89ybw3p8
11. Dtxsid5060510
12. Refchem:818755
13. Dtxcid4042703
14. 209-935-0
15. N-methyl Urea
16. Mfcd00007950
17. 1-methylurea;1-methylurea
18. Methylharnstoff [german]
19. Methylmocovina [czech]
20. Ccris 9137
21. Einecs 209-935-0
22. Methylisourea
23. Methyl-urea
24. Ai3-15088
25. 3-methyl-urea
26. N-methylurea, 97%
27. Ch3nhconh2
28. Bmse000738
29. Unii-vz89ybw3p8
30. Ec 209-935-0
31. Schembl10181
32. Schembl31472
33. Schembl55198
34. Schembl425945
35. Gtpl4662
36. Schembl2887632
37. Schembl4593047
38. Schembl7124696
39. Schembl30707875
40. Chebi:44383
41. Str01326
42. Ac8061
43. Bbl013131
44. Stk400004
45. Akos000120665
46. Cs-w016687
47. Sy018863
48. Db-053475
49. M0455
50. Ns00006191
51. En300-17436
52. N-methylurea, Vetec(tm) Reagent Grade, 97%
53. F227727
54. L000900
55. Q5476523
56. Z56932989
57. F0001-1568
58. Inchi=1/c2h6n2o/c1-4-2(3)5/h1h3,(h3,3,4,5
59. 608090-15-9
| Molecular Weight | 74.08 g/mol |
|---|---|
| Molecular Formula | C2H6N2O |
| XLogP3 | -1.4 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | Da |
| Monoisotopic Mass | Da |
| Topological Polar Surface Area | 55.1 |
| Heavy Atom Count | 5 |
| Formal Charge | 0 |
| Complexity | 42.9 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
BUILDING BLOCK
CAS Number : 598-50-5
End Use API :
End Use API : Theobromine
About the Company : Hebei AiYoung Pharmaceutical Group is an integrated pharmaceutical company engaged in the production, research, and sale of chemical medicines, APIs, intermediates, and finished formula...