


1. 8-chloro-3-beta-diethylaminoethyl-4-methyl-7-ethyoxycarbonymethoxycoumarin
2. 8-chlorocarbochromen
3. 8-chlorocarbochromen Hydrochloride
4. 8-monochloro-3-beta-diethylaminoethyl-4-methyl-7-ethoxycarboxylmethoxycoumarin
5. Ad 6
6. Ad(6)
7. Ad6
8. Cloricromene
1. Cloricromene
2. 68206-94-0
3. 8-chlorocarbochromen
4. Cloricromen [inn]
5. Proendotel
6. Ad-6
7. Acetic Acid, ((8-chloro-3-(2-(diethylamino)ethyl)-4-methyl-2-oxo-2h-1-benzopyran-7-yl)oxy)-, Ethyl Ester
8. B9454pe93c
9. Cloricromen (inn)
10. Ethyl ((8-chloro-3-(2-(diethylamino)ethyl)-4-methyl-2-oxo-2h-1-benzopyran-7-yl)oxy)acetate
11. Cloricromene [french]
12. Cloricromenum [latin]
13. Cloricromeno
14. Cloricromeno [spanish]
15. Cloricromenum
16. Ad 6 (pharmaceutical)
17. Ethyl [[8-chloro-3-[2-(diethylamino)ethyl]-4-methyl-2-oxo-2h-1-benzopyran-7-yl]oxy]acetate
18. Ethyl 2-[8-chloro-3-[2-(diethylamino)ethyl]-4-methyl-2-oxochromen-7-yl]oxyacetate
19. Ncgc00165769-02
20. Unii-b9454pe93c
21. Cloricromen [mi]
22. Cloricromen [mart.]
23. Cloricromen [who-dd]
24. Schembl133346
25. Chembl255066
26. Dtxsid2048373
27. Chebi:135628
28. Zinc576842
29. Db13367
30. Ethyl 2-(8-chloro-3-(2-(diethylamino)ethyl)-4-methyl-2-oxo-2h-chromen-7-yloxy)acetate
31. Ncgc00165769-01
32. Db-055121
33. Ft-0603198
34. D07139
35. 206c940
36. Q5135145
37. O=c(occ)coc1=cc=c(c(o2)=c1cl)c(c)=c(ccn(cc)cc)c2=o
| Molecular Weight | 395.9 g/mol |
|---|---|
| Molecular Formula | C20H26ClNO5 |
| XLogP3 | 3.8 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 10 |
| Exact Mass | 395.1499506 g/mol |
| Monoisotopic Mass | 395.1499506 g/mol |
| Topological Polar Surface Area | 65.1 Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 561 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
Platelet Aggregation Inhibitors
Drugs or agents which antagonize or impair any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. (See all compounds classified as Platelet Aggregation Inhibitors.)
B - Blood and blood forming organs
B01 - Antithrombotic agents
B01A - Antithrombotic agents
B01AC - Platelet aggregation inhibitors excl. heparin
B01AC02 - Cloricromen