


1. Aminodiphenylmethane
2. 91-00-9
3. Diphenylmethanamine
4. 1,1-diphenylmethylamine
5. (diphenylmethyl)amine
6. 1,1-diphenylmethanamine
7. Alpha-phenylbenzylamine
8. Benzenemethanamine, Alpha-phenyl-
9. Methanamine, 1,1-diphenyl-
10. Alpha-aminodiphenylmethane
11. Mfcd00008059
12. Nsc 49127
13. .alpha.-phenylbenzylamine
14. Benzenemethanamine, .alpha.-phenyl-
15. 4bo6iss9dx
16. .alpha.-aminodiphenylmethane
17. Methylamine, 1,1-diphenyl-
18. Nsc-49127
19. En300-15665
20. Benzhydrylamin
21. Benzhydryl Amine
22. Alpha-phenylbenzenemethanamine
23. Einecs 202-032-2
24. Unii-4bo6iss9dx
25. Benzhydryl-amine
26. Diphenylmethyamine
27. Diphenyl-methanamine
28. Aminodiphenyl Methane
29. Aminodiphenyl-methane
30. Benzhydrylamine, 97%
31. C,c-diphenylmethylamine
32. Ph2chnh2
33. C,c-diphenyl-methylamine
34. Methanamine,1-diphenyl-
35. Methylamine,1-diphenyl-
36. 1,1-diphenyl Methylamine
37. Benzhydrylamine (aminodiphenylmethane)
38. Schembl7841
39. Benzhydrylamine [mi]
40. Oprea1_187555
41. Chembl467503
42. Schembl1573580
43. Dtxsid00238346
44. Bdbm626027
45. Hms1785l01
46. Amy10403
47. Bcp18638
48. Cs-d1366
49. Nsc49127
50. Bbl009929
51. Stk801347
52. Akos000120236
53. Pb10011
54. As-12859
55. Bp-11378
56. Benzhydrylamine, Purum, >=97.0% (gc)
57. Db-032196
58. B0124
59. Ns00039384
60. A25935
61. Q-103472
62. Q-200624
63. Q27259384
64. Amikacin Sulfate, Antibiotic For Culture Media Use Only
65. F0850-6748
66. Alpha-phenyl-benzenemethanamin;alpha-phenylbenzenemethanamine
67. 0xm
68. Inchi=1/c13h13n/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13h,14h
| Molecular Weight | 183.25 g/mol |
|---|---|
| Molecular Formula | C13H13N |
| XLogP3 | 2.4 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | g/mol |
| Monoisotopic Mass | g/mol |
| Topological Polar Surface Area | 26 |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 137 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |