1. 2,4-dichloro-1-nitrobenzene
1. 611-06-3
2. 2,4-dichloro-1-nitrobenzene
3. Benzene, 2,4-dichloro-1-nitro-
4. 1,3-dichloro-4-nitrobenzene
5. Dtxsid3024998
6. 85p1a896rr
7. Nsc-43196
8. Dtxcid104998
9. Refchem:82387
10. 4-nitro-1,3-dichlorobenzene
11. 210-248-3
12. Mfcd00007071
13. Ccris 3095
14. Hsdb 4267
15. Einecs 210-248-3
16. Nsc 43196
17. Brn 1451655
18. Unii-85p1a896rr
19. 2,4-dichloro-1-nitro-benzene
20. Benzene, 1,3-dichloro-4-nitro
21. Benzene, 2,4-dichloro-1-nitro-; 2,4-dichloro-1-nitrobenzene; 1,3-dichloro-4-nitrobenzene; 2,4-dichloronitrobenzene; 4-nitro-1,3-dichlorobenzene; Nsc 43196
22. Nitro-m-dichlorobenzene
23. 2,4-dichloronitrobenzen
24. 2,4-dichloro-nitrobenzene
25. 2, 4-dichloronitrobenzene
26. Ec 210-248-3
27. 2,4-dichloro Nitro Benzene
28. Ghl.pd_mitscher_leg0.937
29. Benzene,4-dichloro-1-nitro-
30. Schembl487215
31. Chembl166050
32. Schembl6501572
33. Schembl8761327
34. Schembl11140091
35. Schembl29398960
36. Dichloronitrobenzene, 2,4-
37. Nsc43196
38. Tox21_200204
39. Sbb061648
40. 2,4-dichloro-1-nitrobenzene, 97%
41. Akos009156373
42. Ac-2533
43. Fd34637
44. Gs-3043
45. 2,4-dichloronitrobenzene [hsdb]
46. Msk001906-1000m
47. Ncgc00091267-01
48. Ncgc00091267-02
49. Ncgc00257758-01
50. Cas-611-06-3
51. D0982
52. Ns00002924
53. St50826500
54. En300-49162
55. A833046
56. F079236
57. Q2705544
58. 2,4-dichloro-1-nitrobenzene, Purum, >=98.0% (gc)
59. 2,4-dichloronitrobenzene Solution In Methanol, 1000ug/ml
60. Inchi=1/c6h3cl2no2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3
| Molecular Weight | 192.00 g/mol |
|---|---|
| Molecular Formula | C6H3Cl2NO2 |
| XLogP3 | 3.1 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | Da |
| Monoisotopic Mass | Da |
| Topological Polar Surface Area | 45.8 |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 159 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
The metabolism of 2,3-, 2,4-, 2,5-, 2,6-, 3,4-, and 3,5-dichloro-1-nitrobenzene by Mucor javanicus was investigated, together with 2,4-dichloro-1-nitrobenzene metabolism by other fungi. The main metabolites were the corresponding dichloroanilines, accompanied by a lesser amt of 2,5-dichloro-1-nitrobenzene and 2,6-dichloro-1-nitrobenzene (3-or4-substituted) from 2,3-dichloro-1-nitrobenzene or 2,4-dichloro-1-nitrobenzene, respectively. Similar metabolic patterns were observed with M griseocyanus, M praini, M hiemalis, or Aspergillus flavus.
Hafsah Z et al; Nippon Noyaku Gakaishi 9 (1): 117-23 (1984)
