

1. Cyanoacetamide
1. 107-91-5
2. Cyanoacetamide
3. Acetamide, 2-cyano-
4. Cyanacetamide
5. Malonamide Nitrile
6. Malonamonitrile
7. Nitrilomalonamide
8. Cyanoiminoacetic Acid
9. 3-nitrilo-propionamide
10. Propionamide, 3-nitrilo-
11. Usaf Kf-14
12. Kyanacetamid
13. Cyano Acetamide
14. Nsc 6285
15. 2-cyano-acetamide
16. Alpha-cyanoacetamide
17. .alpha.-cyanoacetamide
18. Amid Kyseliny Kyanoctove
19. Mfcd00008024
20. Ybk38g2yxh
21. Chembl2333142
22. Nsc-6285
23. Wln: Zv1cn
24. Propionamide Nitrile
25. Kyanacetamid (czech)
26. Amid Kyseliny Kyanoctove (czech)
27. Hsdb 2817
28. Malonic Acid, Monoamide Mononitrile
29. Einecs 203-531-8
30. Unii-ybk38g2yxh
31. Brn 0878221
32. 2-cyanoacetamid
33. Ai3-20147
34. 2-cyanoethanamide
35. 2-cyano Acetamide
36. Alpha-cyano-acetamide
37. Cyanoacetamide, 99%
38. Cyanoacetamide [mi]
39. Ec 203-531-8
40. Cyanoacetamide [hsdb]
41. Dtxsid2051552
42. Nsc6285
43. Nsc8948
44. Nsc-8948
45. Bdbm50428735
46. Akos000118770
47. Bp-21030
48. Am20080019
49. Cs-0006665
50. Ft-0612105
51. Ns00006407
52. En300-17156
53. W18657
54. 2-cyanoacetamide (en)acetamide, 2-cyano- (en)
55. A801779
56. Q-102768
57. Q1146906
58. Z56896153
59. F0001-0146
60. Inchi=1/c3h4n2o/c4-2-1-3(5)6/h1h2,(h2,5,6
61. Propanedioic Acid,monoamide,mononitrile Malonic Acid,monoamide,mononitrile
62. Xhd
| Molecular Weight | 84.08 g/mol |
|---|---|
| Molecular Formula | C3H4N2O |
| XLogP3 | -1 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | g/mol |
| Monoisotopic Mass | g/mol |
| Topological Polar Surface Area | 66.9 |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 98.6 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
200 to 300 milligrams for an adult human (cyanide salts). (T86)
Organic nitriles are converted into cyanide ions through the action of cytochrome P450 enzymes in the liver. Cyanide is rapidly absorbed and distributed throughout the body. Cyanide is mainly metabolized into thiocyanate by either rhodanese or 3-mercaptopyruvate sulfur transferase. Cyanide metabolites are excreted in the urine. (L96)
BUILDING BLOCK
MARKET PLACE