N-Methyl-2,2-diphenylethenimine

1 2D Structure

N-Methyl-2,2-Diphenylethenimine

2 Identification

2.1 Computed Descriptors

2.1.1 InChI

InChI=1S/C15H13N/c1-16-12-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H3

2.1.2 InChI Key

CXCYOMOOENLRBS-UHFFFAOYSA-N

2.1.3 Canonical SMILES

CN=C=C(C1=CC=CC=C1)C2=CC=CC=C2

2.2 Synonyms

2.2.1 Depositor-Supplied Synonyms

1. Chembl345273

2. N-methyl-2,2-diphenylethenimine

3. N-(diphenylethenylidene)methanamine

4. Diphenylketene-n-methylimine

5. Schembl11587554

6. Ketinimine,diphenyl,n-methyl

7. Nsc22533

8. Zinc1590085

9. Bdbm50123265

10. Nsc-22533

11. Methanamine, N-(diphenylethenylidene)-

12. N-(2,2-diphenylethenylidene)methanamine #

13. Benzene, 1,1'-[(methylimino)ethenylidene]bis-

2.3 Create Date

2005-03-27

3 Chemical and Physical Properties

Molecular Formula	C₁₅H₁₃N
Molecular Weight	207.27 g/mol
XLogP3	4.4
Hydrogen Bond Donor Count	0
Hydrogen Bond Acceptor Count	1
Rotatable Bond Count	2
Exact Mass	207.104799419 g/mol
Monoisotopic Mass	207.104799419 g/mol
Topological Polar Surface Area	12.4 Å²
Heavy Atom Count	16
Formal Charge	0
Complexity	241
Isotope Atom Count	0
Defined Atom Stereocenter Count	0
Undefined Atom Stereocenter Count	0
Defined Bond Stereocenter Count	0
Undefined Bond Stereocenter Count	0
Covalently Bonded Unit Count	1

N-Methyl-2,2-Diphenylethenimine manufacturers and suppliers on PharmaCompass