X
1. 563-83-7
2. 2-methylpropanamide
3. 2-methylpropionamide
4. Propanamide, 2-methyl-
5. Isobutyrimidic Acid
6. Isobutylamide
7. Mfcd00008019
8. 82uoe7b38z
9. Nsc-8423
10. Dimethylacetoamide
11. Nsc 8423
12. Einecs 209-265-9
13. Brn 1737615
14. Unii-82uoe7b38z
15. C-isopropylformamide
16. 2-methyl-propanamide
17. Isobutyric Acid Amide
18. Isobutyramide, 99%
19. 68424-61-3
20. 1-carbamoyl-1-methylethyl
21. 4-02-00-00852 (beilstein Handbook Reference)
22. Chembl352219
23. Glycerides, C16-18 And C18-unsatd. Mono- And Di-
24. Dtxsid1060340
25. Nsc8423
26. Chebi:193555
27. Bdbm50224866
28. Akos001084432
29. Cs-w019979
30. Nci60_041854
31. Sy015332
32. Ft-0627380
33. Ft-0672107
34. I0102
35. En300-17833
36. W-105521
37. Q10859786
38. Z57046209
39. Inchi=1/c4h9no/c1-3(2)4(5)6/h3h,1-2h3,(h2,5,6
40. Ibo
1. 2-methylpropanamide
2. Isopropylformamide
| Molecular Weight | 87.12 g/mol |
|---|---|
| Molecular Formula | C4H9NO |
| XLogP3 | 0.2 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | g/mol |
| Monoisotopic Mass | g/mol |
| Topological Polar Surface Area | 43.1 |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 58.6 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
Antineoplastic Agents
Substances that inhibit or prevent the proliferation of NEOPLASMS. (See all compounds classified as Antineoplastic Agents.)
Market Place
