1. 563-83-7
2. 2-methylpropanamide
3. 2-methylpropionamide
4. Propanamide, 2-methyl-
5. Isobutyrimidic Acid
6. Isobutylamide
7. Mfcd00008019
8. 82uoe7b38z
9. Nsc-8423
10. Dimethylacetoamide
11. Nsc 8423
12. Einecs 209-265-9
13. Brn 1737615
14. Unii-82uoe7b38z
15. C-isopropylformamide
16. 2-methyl-propanamide
17. Isobutyric Acid Amide
18. Isobutyramide, 99%
19. 68424-61-3
20. 1-carbamoyl-1-methylethyl
21. 4-02-00-00852 (beilstein Handbook Reference)
22. Chembl352219
23. Glycerides, C16-18 And C18-unsatd. Mono- And Di-
24. Dtxsid1060340
25. Nsc8423
26. Chebi:193555
27. Bdbm50224866
28. Akos001084432
29. Cs-w019979
30. Nci60_041854
31. Sy015332
32. Ft-0627380
33. Ft-0672107
34. I0102
35. En300-17833
36. W-105521
37. Q10859786
38. Z57046209
39. Inchi=1/c4h9no/c1-3(2)4(5)6/h3h,1-2h3,(h2,5,6
40. Ibo
1. 2-methylpropanamide
2. Isopropylformamide
Molecular Weight | 87.12 g/mol |
---|---|
Molecular Formula | C4H9NO |
XLogP3 | 0.2 |
Hydrogen Bond Donor Count | 1 |
Hydrogen Bond Acceptor Count | 1 |
Rotatable Bond Count | 1 |
Exact Mass | g/mol |
Monoisotopic Mass | g/mol |
Topological Polar Surface Area | 43.1 |
Heavy Atom Count | 6 |
Formal Charge | 0 |
Complexity | 58.6 |
Isotope Atom Count | 0 |
Defined Atom Stereocenter Count | 0 |
Undefined Atom Stereocenter Count | 0 |
Defined Bond Stereocenter Count | 0 |
Undefined Bond Stereocenter Count | 0 |
Covalently Bonded Unit Count | 1 |
Antineoplastic Agents
Substances that inhibit or prevent the proliferation of NEOPLASMS. (See all compounds classified as Antineoplastic Agents.)
BUILDING BLOCK
CAS Number : 563-83-7
End Use API :
End Use API : Ethionamide
About the Company : "The Company’s product portfolio includes a wide range of products such as Acetyl Intermediates, Speciality Intermediates, and Fluorine Intermediates. These products serve diverse app...