

1. 50715-28-1
2. Cyclopentyl Carbonochloridate
3. Cyclopentylchloroformate
4. Mfcd00144029
5. Carbonochloridic Acid, Cyclopentyl Ester
6. Cyclopentyl Chlorocarbonate
7. Cyclopentylcarbonochloridate
8. Ec 411-460-0
9. Schembl67220
10. Zfqcrlnkhhxelh-uhfffaoysa-
11. Dtxsid00371005
12. Zfqcrlnkhhxelh-uhfffaoysa-n
13. Akos006230402
14. As-58401
15. Sy019967
16. Ft-0600800
17. En300-206219
18. A851956
19. J-520182
20. F2158-1504
21. Inchi=1/c6h9clo2/c7-6(8)9-5-3-1-2-4-5/h5h,1-4h2
| Molecular Weight | 148.59 g/mol |
|---|---|
| Molecular Formula | C6H9ClO2 |
| XLogP3 | 2.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | g/mol |
| Monoisotopic Mass | g/mol |
| Topological Polar Surface Area | 26.3 |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 108 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
BUILDING BLOCK
CAS Number : 50715-28-1
End Use API :
End Use API : Zafirlukast
About the Company : PMC Isochem, acquired by PMC International in 2017, is a CDMO manufacturing cGMP intermediates, APIs, and functional excipients for global pharmaceutical and personal care companies. It...