

1. 1-(2-methoxyphenyl)piperazine Dihydrochloride
2. 1-(2-methoxyphenyl)piperazine Hydrochloride
3. 1-(ortho-methoxyphenyl)piperazine
4. O-methoxyphenylpiperazine
1. 35386-24-4
2. N-(2-methoxyphenyl)piperazine
3. Piperazine, 1-(2-methoxyphenyl)-
4. O-methoxyphenylpiperazine
5. 81njo1330a
6. Piperazine, 1-(o-methoxyphenyl)-
7. Einecs 252-537-7
8. 2-meopp
9. Vnzlqlybriolfz-uhfffaoysa-
10. Dtxsid40188871
11. D-15157
12. 1-(ortho-methoxyphenyl)piperazine
13. Dtxcid00111362
14. 252-537-7
15. Inchi=1/c11h16n2o/c1-14-11-5-3-2-4-10(11)13-8-6-12-7-9-13/h2-5,12h,6-9h2,1h3
16. 1-(2-methoxyphenyl)-piperazine
17. 2-mpp
18. 1-(o-methoxyphenyl)piperazine
19. 1-(2-methoxy-phenyl)-piperazine
20. 2-methoxyphenylpiperazine
21. Mfcd00005958
22. 1-(2-methoxy Phenyl) Piperazine
23. 2-(1-piperazinyl)anisole
24. 1-(2-methoxyphenyl) Piperazine
25. Chembl9666
26. Spectrum_000433
27. Unii-81njo1330a
28. Specplus_000789
29. (methoxyphenyl)piperazine
30. 1-(o-anisyl)piperazine
31. Lopac-s-008
32. Spectrum2_001818
33. Spectrum3_001032
34. Spectrum4_001166
35. Spectrum5_001749
36. 2-methoxy-phenylpiperazine
37. 2-methoxyphenyl Piperazine
38. 2-methoxyphenyl-piperazine
39. Schembl379
40. 1-o-methoxyphenylpiperazine
41. 2-methyloxyphenyl-piperazine
42. 2-(piperazin-1-yl)anisole
43. Lopac0_001122
44. Oprea1_660972
45. Oprea1_668117
46. 4-(methoxyphenyl)-piperazine
47. Bspbio_002843
48. Gtpl280
49. Kbiogr_001771
50. Kbioss_000913
51. N-(o-methoxyphenyl)piperazine
52. 1- (2-methoxyphenyl)pierazine Hydrochloride
53. 4-(2-methoxypheny)piperazine
54. 1(2methyoxyphenyl)-piperazine
55. Divk1c_006885
56. (2-methoxy-phenyl)-piperazine
57. 4-(2-methoxyphenyl)piperazine
58. Spbio_001835
59. 1-(2-methoxyphenyl)-piperazin
60. 1-(o-methoxyphenyl)-piperazine
61. N-(2-methoxyphenyl)-piperazine
62. 1-(2'-methoxyphenyl)piperazine
63. 1-(2-methoxy-phenyl)piperazine
64. 1-(2-methyloxyphenyl)piperazine
65. 4-(2-methoxyphenyl)-piperazine
66. 1-(2-methoxylphenyl)-piperazine
67. Kbio1_001829
68. Kbio2_000913
69. Kbio2_003481
70. Kbio2_006049
71. Kbio3_002063
72. 1-(2-methoxy-phenyl) Piperazine
73. Chebi:104020
74. 1-[2-(methyloxy)phenyl]piperazine
75. Bbl012589
76. Bdbm50001862
77. Pdsp1_001239
78. Pdsp2_001223
79. Stk397877
80. 1-(2-methoxyphenyl)piperazine, 98%
81. Akos000101051
82. Ac-2527
83. Ccg-202925
84. Cs-w010700
85. Fm25333
86. Lf-0547
87. Sdccgsbi-0051090.p003
88. 4-(2-methoxy-phenyl)-piperazin-1-ium
89. Ncgc00015906-01
90. Ncgc00015906-02
91. Ncgc00015906-03
92. Ncgc00015906-06
93. Ncgc00162350-01
94. Ac-23380
95. Bp-12272
96. Pd013680
97. Db-024573
98. M0883
99. Ns00009188
100. En300-33366
101. D77710
102. D 15157
103. L001193
104. Brd-k70343553-003-02-7
105. Brd-k70343553-003-06-8
106. Q27072540
107. F2190-0351
108. (n-(o-methoxyphenyl)piperazine)1-(2-methoxy-phenyl)-piperazine
109. 1-(o-methoxyphenyl)-piperazine;1-(2-methoxyphenyl)piperazine;1-(o-anisyl)piperazine
| Molecular Weight | 192.26 g/mol |
|---|---|
| Molecular Formula | C11H16N2O |
| XLogP3 | 1.4 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | Da |
| Monoisotopic Mass | Da |
| Topological Polar Surface Area | 24.5 |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 169 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
BUILDING BLOCK