

1. 33924-48-0
2. Methyl 5-chloro-o-anisate
3. Benzoic Acid, 5-chloro-2-methoxy-, Methyl Ester
4. 5-chloro-2-methoxybenzoic Acid Methyl Ester
5. Methyl-5-chloro-2-methoxybenzoate
6. Methyl 5-chloro-2-methoxy-d3-benzoate
7. 4-chloro-2-(methoxycarbonyl)anisole
8. Methyl 5-choro-2-methoxybenzoate
9. Mfcd00017511
10. 1219803-33-4
11. Dtxsid8057720
12. 5-chloro-2-methoxy-benzoicacidmethylester-13c2,d6
13. Methyl5-chloro-2-methoxybenzoate
14. Einecs 251-743-4
15. 5-chloro-o-anisic Acid Methyl Ester
16. 5-chloro-2-methoxy-benzoic Acid Methyl Ester
17. Au3x59v4wd
18. Schembl1095516
19. Chembl3188482
20. Dtxcid5031509
21. Methyl 5-chloro-2-methoxy-benzoate
22. Tox21_113805
23. Akos000120261
24. Cs-w015589
25. Ncgc00253681-01
26. As-61401
27. Methyl 5-chloro-2-methoxybenzoate, 98%
28. Sy048291
29. Cas-33924-48-0
30. Db-048527
31. Ns00029571
32. En300-15445
33. D89410
34. A822001
35. Sr-01000944765
36. Sr-01000944765-1
37. W-106762
38. Brd-k98822077-001-01-1
39. Z16189275
40. Inchi=1/c9h9clo3/c1-12-8-4-3-6(10)5-7(8)9(11)13-2/h3-5h,1-2h
| Molecular Weight | 200.62 g/mol |
|---|---|
| Molecular Formula | C9H9ClO3 |
| XLogP3 | 3.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | g/mol |
| Monoisotopic Mass | g/mol |
| Topological Polar Surface Area | 35.5 |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 184 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
BUILDING BLOCK
5-Chloro-o-anisic acid methyl ester
CAS Number : 33924-48-0
End Use API :
End Use API : Glibenclamide
About the Company : Medilux Laboratories has been providing quality back-end support to the pharmaceutical industry since our inception in 1988. Our resources are dedicated to promoting better health throu...
