

1. 2969-81-5
2. Butanoic Acid, 4-bromo-, Ethyl Ester
3. Einecs 221-005-6
4. Nsc 133462
5. Ai3-36601
6. Dtxsid80183845
7. Dtxcid20106336
8. Butanoic Acid, 4bromo, Ethyl Ester
9. Butanoic Acid, 4bromo, Ethyl Ester (9ci)
10. Butanoic Acid, 4-bromo-, Ethyl Ester (9ci)
11. 221-005-6
12. Ethyl 4-bromobutanoate
13. 4-bromobutyric Acid Ethyl Ester
14. Mfcd00000259
15. Ethyl4-bromobutyrate
16. 4-bromo-butyric Acid Ethyl Ester
17. Brch2ch2ch2c(o)oc2h5
18. 4-bromobutanoic Acid Ethyl Ester
19. Nsc-133462
20. Ethyl-4-bromobutyrate
21. 4-bromo-n-butyric Acid Ethyl Ester
22. Ethyl 4bromobutyrate
23. Ethyl4-bromobutanoate
24. Ethyl 4-bromobutanate
25. Ethyl-4-bromobutanoate
26. Ethyl 4- Bromobutyrate
27. Ethyl 4-bromo-butyrate
28. Ethyl-4-bromo-butyrate
29. Ethyl Gamma-bromobutyrate
30. Ethyl 4-bromo-n-butyrate
31. Ethyl 4-bromobutanoate #
32. Ez8ty5jsd5
33. Ethyl .gamma.-bromobutyrate
34. 4-bromobutanoate Ethyl Ester
35. Schembl85568
36. 1-bromo-3-carboethoxypropane
37. Ethyl 4-bromobutyrate, 95%
38. 3-(ethoxycarbonyl)propyl Bromide
39. Xbpobcxhalhjfp-uhfffaoysa-
40. 4-bromobutanoic Acid, Ethyl Ester
41. Str05803
42. Nsc133462
43. Akos005066835
44. Cs-w020133
45. Fb29734
46. Bp-12819
47. Bp-31132
48. Db-029752
49. B0999
50. Ns00022005
51. En300-43960
52. F11167
53. F0001-0919
54. Inchi=1/c6h11bro2/c1-2-9-6(8)4-3-5-7/h2-5h2,1h3
| Molecular Weight | 195.05 g/mol |
|---|---|
| Molecular Formula | C6H11BrO2 |
| XLogP3 | 1.5 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 5 |
| Exact Mass | Da |
| Monoisotopic Mass | Da |
| Topological Polar Surface Area | 26.3 |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 83.1 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently Bonded Unit Count | 1 |
BUILDING BLOCK